C27H27NO4S — CID 91211692
4-[2-ethyl-5-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione (PubChem CID 91211692) has the molecular formula C27H27NO4S and a molecular weight of 461.58 g/mol. Its IUPAC name is 4-[2-ethyl-5-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione.
| Compound Name | 4-[2-ethyl-5-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 91211692 |
| Molecular Formula | C27H27NO4S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 4-[2-ethyl-5-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione |
| SMILES | CCc1ccc(Oc2nc3ccc(OC)cc3s2)cc1C1C(=O)C2C3CCC(CC3)C2C1=O |
| InChI | InChI=1S/C27H27NO4S/c1-3-14-8-9-18(32-27-28-20-11-10-17(31-2)13-21(20)33-27)12-19(14)24-25(29)22-15-4-5-16(7-6-15)23(22)26(24)30/h8-13,15-16,22-24H,3-7H2,1-2H3 |
| InChIKey | IHROAOCZBZBWCW-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|