C24H23FO3 — CID 91246969
4-[2-ethyl-5-(4-fluorophenoxy)phenyl]tricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 91246969) has the molecular formula C24H23FO3 and a molecular weight of 378.44 g/mol. Its IUPAC name is 4-[2-ethyl-5-(4-fluorophenoxy)phenyl]tricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 4-[2-ethyl-5-(4-fluorophenoxy)phenyl]tricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 91246969 |
| Molecular Formula | C24H23FO3 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 4-[2-ethyl-5-(4-fluorophenoxy)phenyl]tricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCc1ccc(Oc2ccc(F)cc2)cc1C1C(=O)C2C3CCC(C3)C2C1=O |
| InChI | InChI=1S/C24H23FO3/c1-2-13-5-8-18(28-17-9-6-16(25)7-10-17)12-19(13)22-23(26)20-14-3-4-15(11-14)21(20)24(22)27/h5-10,12,14-15,20-22H,2-4,11H2,1H3 |
| InChIKey | DDSOXGYYFOQZDZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|