C26H25NO3S — CID 91295041
4-[5-(1,3-benzothiazol-2-yloxy)-2-ethylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione (PubChem CID 91295041) has the molecular formula C26H25NO3S and a molecular weight of 431.56 g/mol. Its IUPAC name is 4-[5-(1,3-benzothiazol-2-yloxy)-2-ethylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione.
| Compound Name | 4-[5-(1,3-benzothiazol-2-yloxy)-2-ethylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 91295041 |
| Molecular Formula | C26H25NO3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 4-[5-(1,3-benzothiazol-2-yloxy)-2-ethylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione |
| SMILES | CCc1ccc(Oc2nc3ccccc3s2)cc1C1C(=O)C2C3CCC(CC3)C2C1=O |
| InChI | InChI=1S/C26H25NO3S/c1-2-14-11-12-17(30-26-27-19-5-3-4-6-20(19)31-26)13-18(14)23-24(28)21-15-7-8-16(10-9-15)22(21)25(23)29/h3-6,11-13,15-16,21-23H,2,7-10H2,1H3 |
| InChIKey | VMMXIMJXZGAOTQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|