C25H27NO5S — CID 123995758
4-[2-ethyl-5-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]-2,2,6,6-tetramethyloxane-3,5-dione (PubChem CID 123995758) has the molecular formula C25H27NO5S and a molecular weight of 453.56 g/mol. Its IUPAC name is 4-[2-ethyl-5-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]-2,2,6,6-tetramethyloxane-3,5-dione.
| Compound Name | 4-[2-ethyl-5-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
|---|---|
| PubChem CID | 123995758 |
| Molecular Formula | C25H27NO5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 4-[2-ethyl-5-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
| SMILES | CCc1ccc(Oc2nc3ccc(OC)cc3s2)cc1C1C(=O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C25H27NO5S/c1-7-14-8-9-16(30-23-26-18-11-10-15(29-6)13-19(18)32-23)12-17(14)20-21(27)24(2,3)31-25(4,5)22(20)28/h8-13,20H,7H2,1-6H3 |
| InChIKey | MMPUJENHDMZJJP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|