C23H24Cl2O4 — CID 91414693
4-[5-(2,4-dichlorophenoxy)-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione (PubChem CID 91414693) has the molecular formula C23H24Cl2O4 and a molecular weight of 435.35 g/mol. Its IUPAC name is 4-[5-(2,4-dichlorophenoxy)-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione.
| Compound Name | 4-[5-(2,4-dichlorophenoxy)-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
|---|---|
| PubChem CID | 91414693 |
| Molecular Formula | C23H24Cl2O4 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 4-[5-(2,4-dichlorophenoxy)-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
| SMILES | CCc1ccc(Oc2ccc(Cl)cc2Cl)cc1C1C(=O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C23H24Cl2O4/c1-6-13-7-9-15(28-18-10-8-14(24)11-17(18)25)12-16(13)19-20(26)22(2,3)29-23(4,5)21(19)27/h7-12,19H,6H2,1-5H3 |
| InChIKey | PBTVEYLBQNXTQZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|