C24H24ClNO4 — CID 91517658
2-chloro-4-[4-ethyl-3-(2,2,6,6-tetramethyl-3,5-dioxooxan-4-yl)phenoxy]benzonitrile (PubChem CID 91517658) has the molecular formula C24H24ClNO4 and a molecular weight of 425.91 g/mol. Its IUPAC name is 2-chloro-4-[4-ethyl-3-(2,2,6,6-tetramethyl-3,5-dioxooxan-4-yl)phenoxy]benzonitrile.
| Compound Name | 2-chloro-4-[4-ethyl-3-(2,2,6,6-tetramethyl-3,5-dioxooxan-4-yl)phenoxy]benzonitrile |
|---|---|
| PubChem CID | 91517658 |
| Molecular Formula | C24H24ClNO4 |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-chloro-4-[4-ethyl-3-(2,2,6,6-tetramethyl-3,5-dioxooxan-4-yl)phenoxy]benzonitrile |
| SMILES | CCc1ccc(Oc2ccc(C#N)c(Cl)c2)cc1C1C(=O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C24H24ClNO4/c1-6-14-7-9-16(29-17-10-8-15(13-26)19(25)12-17)11-18(14)20-21(27)23(2,3)30-24(4,5)22(20)28/h7-12,20H,6H2,1-5H3 |
| InChIKey | PCYIBGMONYIZAV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|