C23H23Cl3O3 — CID 90911567
4-[2-ethyl-5-(3,4,5-trichlorophenyl)phenyl]-2,2,6,6-tetramethyloxane-3,5-dione (PubChem CID 90911567) has the molecular formula C23H23Cl3O3 and a molecular weight of 453.79 g/mol. Its IUPAC name is 4-[2-ethyl-5-(3,4,5-trichlorophenyl)phenyl]-2,2,6,6-tetramethyloxane-3,5-dione.
| Compound Name | 4-[2-ethyl-5-(3,4,5-trichlorophenyl)phenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
|---|---|
| PubChem CID | 90911567 |
| Molecular Formula | C23H23Cl3O3 |
| Molecular Weight | 453.79 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 4-[2-ethyl-5-(3,4,5-trichlorophenyl)phenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
| SMILES | CCc1ccc(-c2cc(Cl)c(Cl)c(Cl)c2)cc1C1C(=O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C23H23Cl3O3/c1-6-12-7-8-13(14-10-16(24)19(26)17(25)11-14)9-15(12)18-20(27)22(2,3)29-23(4,5)21(18)28/h7-11,18H,6H2,1-5H3 |
| InChIKey | HGYZOKMLFIXEME-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.79 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|