C23H25ClO3S — CID 91077401
4-[5-(4-chlorophenyl)-2-ethylphenyl]-2,2,6,6-tetramethyl-1-oxothiane-3,5-dione (PubChem CID 91077401) has the molecular formula C23H25ClO3S and a molecular weight of 416.97 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)-2-ethylphenyl]-2,2,6,6-tetramethyl-1-oxothiane-3,5-dione.
| Compound Name | 4-[5-(4-chlorophenyl)-2-ethylphenyl]-2,2,6,6-tetramethyl-1-oxothiane-3,5-dione |
|---|---|
| PubChem CID | 91077401 |
| Molecular Formula | C23H25ClO3S |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 4-[5-(4-chlorophenyl)-2-ethylphenyl]-2,2,6,6-tetramethyl-1-oxothiane-3,5-dione |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2)cc1C1C(=O)C(C)(C)S(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C23H25ClO3S/c1-6-14-7-8-16(15-9-11-17(24)12-10-15)13-18(14)19-20(25)22(2,3)28(27)23(4,5)21(19)26/h7-13,19H,6H2,1-5H3 |
| InChIKey | AGWHPUYMKWQLLG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|