C23H21ClO3 — CID 123959064
(1R,2S,6R,7S)-4-[5-(4-chlorophenyl)-2-ethylphenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123959064) has the molecular formula C23H21ClO3 and a molecular weight of 380.87 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-[5-(4-chlorophenyl)-2-ethylphenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-4-[5-(4-chlorophenyl)-2-ethylphenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123959064 |
| Molecular Formula | C23H21ClO3 |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (1R,2S,6R,7S)-4-[5-(4-chlorophenyl)-2-ethylphenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2)cc1C1C(=O)[C@@H]2[C@H](C1=O)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C23H21ClO3/c1-2-12-3-4-14(13-5-7-15(24)8-6-13)11-16(12)19-22(25)20-17-9-10-18(27-17)21(20)23(19)26/h3-8,11,17-21H,2,9-10H2,1H3/t17-,18+,19?,20-,21+ |
| InChIKey | GMDFAIWXODLCTD-YTDWZJOKSA-N |
| XLogP | 4.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|