C24H23ClO2 — CID 123678538
(2R,6S)-4-[5-(4-chlorophenyl)-2-methylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione (PubChem CID 123678538) has the molecular formula C24H23ClO2 and a molecular weight of 378.90 g/mol. Its IUPAC name is (2R,6S)-4-[5-(4-chlorophenyl)-2-methylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione.
| Compound Name | (2R,6S)-4-[5-(4-chlorophenyl)-2-methylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 123678538 |
| Molecular Formula | C24H23ClO2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (2R,6S)-4-[5-(4-chlorophenyl)-2-methylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione |
| SMILES | Cc1ccc(-c2ccc(Cl)cc2)cc1C1C(=O)[C@@H]2C3CCC(CC3)[C@@H]2C1=O |
| InChI | InChI=1S/C24H23ClO2/c1-13-2-3-17(14-8-10-18(25)11-9-14)12-19(13)22-23(26)20-15-4-5-16(7-6-15)21(20)24(22)27/h2-3,8-12,15-16,20-22H,4-7H2,1H3/t15?,16?,20-,21+,22? |
| InChIKey | JNPIQCYTYXSYGN-HFZKXEEVSA-N |
| XLogP | 5.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|