C20H20ClNO2 — CID 123475658
3-[5-(4-chlorophenyl)-2-methylphenyl]-6,6-dimethylpiperidine-2,4-dione (PubChem CID 123475658) has the molecular formula C20H20ClNO2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-2-methylphenyl]-6,6-dimethylpiperidine-2,4-dione.
| Compound Name | 3-[5-(4-chlorophenyl)-2-methylphenyl]-6,6-dimethylpiperidine-2,4-dione |
|---|---|
| PubChem CID | 123475658 |
| Molecular Formula | C20H20ClNO2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-2-methylphenyl]-6,6-dimethylpiperidine-2,4-dione |
| SMILES | Cc1ccc(-c2ccc(Cl)cc2)cc1C1C(=O)CC(C)(C)NC1=O |
| InChI | InChI=1S/C20H20ClNO2/c1-12-4-5-14(13-6-8-15(21)9-7-13)10-16(12)18-17(23)11-20(2,3)22-19(18)24/h4-10,18H,11H2,1-3H3,(H,22,24) |
| InChIKey | KFSFUNMDVLKQNE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|