C24H26ClNO3 — CID 123284062
3-[5-(4-chlorophenyl)-2-methylphenyl]-7-(methoxymethyl)-1-azaspiro[4.5]decane-2,4-dione (PubChem CID 123284062) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-2-methylphenyl]-7-(methoxymethyl)-1-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[5-(4-chlorophenyl)-2-methylphenyl]-7-(methoxymethyl)-1-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 123284062 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-2-methylphenyl]-7-(methoxymethyl)-1-azaspiro[4.5]decane-2,4-dione |
| SMILES | COCC1CCCC2(C1)NC(=O)C(c1cc(-c3ccc(Cl)cc3)ccc1C)C2=O |
| InChI | InChI=1S/C24H26ClNO3/c1-15-5-6-18(17-7-9-19(25)10-8-17)12-20(15)21-22(27)24(26-23(21)28)11-3-4-16(13-24)14-29-2/h5-10,12,16,21H,3-4,11,13-14H2,1-2H3,(H,26,28) |
| InChIKey | FARSNCSEKUKZJZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|