C23H20ClF4NO3 — CID 123302144
3-[5-(4-chlorophenyl)-4-fluoro-2-methylphenyl]-8-hydroxy-8-(trifluoromethyl)-1-azaspiro[4.5]decane-2,4-dione (PubChem CID 123302144) has the molecular formula C23H20ClF4NO3 and a molecular weight of 469.86 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-4-fluoro-2-methylphenyl]-8-hydroxy-8-(trifluoromethyl)-1-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[5-(4-chlorophenyl)-4-fluoro-2-methylphenyl]-8-hydroxy-8-(trifluoromethyl)-1-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 123302144 |
| Molecular Formula | C23H20ClF4NO3 |
| Molecular Weight | 469.86 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-4-fluoro-2-methylphenyl]-8-hydroxy-8-(trifluoromethyl)-1-azaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc(F)c(-c2ccc(Cl)cc2)cc1C1C(=O)NC2(CCC(O)(C(F)(F)F)CC2)C1=O |
| InChI | InChI=1S/C23H20ClF4NO3/c1-12-10-17(25)16(13-2-4-14(24)5-3-13)11-15(12)18-19(30)21(29-20(18)31)6-8-22(32,9-7-21)23(26,27)28/h2-5,10-11,18,32H,6-9H2,1H3,(H,29,31) |
| InChIKey | OWRZVTWUGPLDJI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.86 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|