C24H23Cl2NO4 — CID 123689759
2-[2-chloro-5-(4-chlorophenyl)phenyl]-11-methyl-9,12-dioxa-4-azadispiro[4.2.48.25]tetradecane-1,3-dione (PubChem CID 123689759) has the molecular formula C24H23Cl2NO4 and a molecular weight of 460.36 g/mol. Its IUPAC name is 2-[2-chloro-5-(4-chlorophenyl)phenyl]-11-methyl-9,12-dioxa-4-azadispiro[4.2.48.25]tetradecane-1,3-dione.
| Compound Name | 2-[2-chloro-5-(4-chlorophenyl)phenyl]-11-methyl-9,12-dioxa-4-azadispiro[4.2.48.25]tetradecane-1,3-dione |
|---|---|
| PubChem CID | 123689759 |
| Molecular Formula | C24H23Cl2NO4 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 2-[2-chloro-5-(4-chlorophenyl)phenyl]-11-methyl-9,12-dioxa-4-azadispiro[4.2.48.25]tetradecane-1,3-dione |
| SMILES | CC1COC2(CCC3(CC2)NC(=O)C(c2cc(-c4ccc(Cl)cc4)ccc2Cl)C3=O)O1 |
| InChI | InChI=1S/C24H23Cl2NO4/c1-14-13-30-24(31-14)10-8-23(9-11-24)21(28)20(22(29)27-23)18-12-16(4-7-19(18)26)15-2-5-17(25)6-3-15/h2-7,12,14,20H,8-11,13H2,1H3,(H,27,29) |
| InChIKey | IODKHTYMEWMLMY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|