C24H26ClNO2 — CID 91213569
3-[3-(4-chlorophenyl)-2,6-dimethylphenyl]-8-methyl-1-azaspiro[4.5]decane-2,4-dione (PubChem CID 91213569) has the molecular formula C24H26ClNO2 and a molecular weight of 395.93 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)-2,6-dimethylphenyl]-8-methyl-1-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[3-(4-chlorophenyl)-2,6-dimethylphenyl]-8-methyl-1-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 91213569 |
| Molecular Formula | C24H26ClNO2 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-[3-(4-chlorophenyl)-2,6-dimethylphenyl]-8-methyl-1-azaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1ccc(-c2ccc(Cl)cc2)c(C)c1C1C(=O)NC2(CCC(C)CC2)C1=O |
| InChI | InChI=1S/C24H26ClNO2/c1-14-10-12-24(13-11-14)22(27)21(23(28)26-24)20-15(2)4-9-19(16(20)3)17-5-7-18(25)8-6-17/h4-9,14,21H,10-13H2,1-3H3,(H,26,28) |
| InChIKey | QGYHXXRODALSME-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|