C22H20ClF2NO3 — CID 77242693
3-[2-chloro-5-(3,4-difluorophenyl)phenyl]-8-methoxy-1-azaspiro[4.5]decane-2,4-dione (PubChem CID 77242693) has the molecular formula C22H20ClF2NO3 and a molecular weight of 419.86 g/mol. Its IUPAC name is 3-[2-chloro-5-(3,4-difluorophenyl)phenyl]-8-methoxy-1-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-chloro-5-(3,4-difluorophenyl)phenyl]-8-methoxy-1-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 77242693 |
| Molecular Formula | C22H20ClF2NO3 |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 3-[2-chloro-5-(3,4-difluorophenyl)phenyl]-8-methoxy-1-azaspiro[4.5]decane-2,4-dione |
| SMILES | COC1CCC2(CC1)NC(=O)C(c1cc(-c3ccc(F)c(F)c3)ccc1Cl)C2=O |
| InChI | InChI=1S/C22H20ClF2NO3/c1-29-14-6-8-22(9-7-14)20(27)19(21(28)26-22)15-10-12(2-4-16(15)23)13-3-5-17(24)18(25)11-13/h2-5,10-11,14,19H,6-9H2,1H3,(H,26,28) |
| InChIKey | WWEDGAGONWGMGJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|