C17H20BrNO3 — CID 91082578
3-(2-bromo-5-methylphenyl)-8-(hydroxymethyl)-1-azaspiro[4.5]decane-2,4-dione (PubChem CID 91082578) has the molecular formula C17H20BrNO3 and a molecular weight of 366.26 g/mol. Its IUPAC name is 3-(2-bromo-5-methylphenyl)-8-(hydroxymethyl)-1-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(2-bromo-5-methylphenyl)-8-(hydroxymethyl)-1-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 91082578 |
| Molecular Formula | C17H20BrNO3 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 3-(2-bromo-5-methylphenyl)-8-(hydroxymethyl)-1-azaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1ccc(Br)c(C2C(=O)NC3(CCC(CO)CC3)C2=O)c1 |
| InChI | InChI=1S/C17H20BrNO3/c1-10-2-3-13(18)12(8-10)14-15(21)17(19-16(14)22)6-4-11(9-20)5-7-17/h2-3,8,11,14,20H,4-7,9H2,1H3,(H,19,22) |
| InChIKey | FTFYUQLDWDUTHW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|