C17H20BrNO2 — CID 90735471
3-(3-bromo-2,6-dimethylphenyl)-1-azaspiro[4.5]decane-2,4-dione (PubChem CID 90735471) has the molecular formula C17H20BrNO2 and a molecular weight of 350.26 g/mol. Its IUPAC name is 3-(3-bromo-2,6-dimethylphenyl)-1-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(3-bromo-2,6-dimethylphenyl)-1-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 90735471 |
| Molecular Formula | C17H20BrNO2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 3-(3-bromo-2,6-dimethylphenyl)-1-azaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1ccc(Br)c(C)c1C1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C17H20BrNO2/c1-10-6-7-12(18)11(2)13(10)14-15(20)17(19-16(14)21)8-4-3-5-9-17/h6-7,14H,3-5,8-9H2,1-2H3,(H,19,21) |
| InChIKey | ZMPNIYAICLEOTQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|