C19H24N2O2 — CID 91212908
3-(4-cyclopropyl-2,6-dimethylphenyl)-1,8-diazaspiro[4.5]decane-2,4-dione (PubChem CID 91212908) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 3-(4-cyclopropyl-2,6-dimethylphenyl)-1,8-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(4-cyclopropyl-2,6-dimethylphenyl)-1,8-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 91212908 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3-(4-cyclopropyl-2,6-dimethylphenyl)-1,8-diazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc(C2CC2)cc(C)c1C1C(=O)NC2(CCNCC2)C1=O |
| InChI | InChI=1S/C19H24N2O2/c1-11-9-14(13-3-4-13)10-12(2)15(11)16-17(22)19(21-18(16)23)5-7-20-8-6-19/h9-10,13,16,20H,3-8H2,1-2H3,(H,21,23) |
| InChIKey | XONNTUIHCFHJNE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|