C21H22ClNO3 — CID 90750009
3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5-(2-hydroxyethyl)-5-methylpyrrolidine-2,4-dione (PubChem CID 90750009) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5-(2-hydroxyethyl)-5-methylpyrrolidine-2,4-dione.
| Compound Name | 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5-(2-hydroxyethyl)-5-methylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 90750009 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-5-(2-hydroxyethyl)-5-methylpyrrolidine-2,4-dione |
| SMILES | Cc1cc(-c2ccc(Cl)cc2)cc(C)c1C1C(=O)NC(C)(CCO)C1=O |
| InChI | InChI=1S/C21H22ClNO3/c1-12-10-15(14-4-6-16(22)7-5-14)11-13(2)17(12)18-19(25)21(3,8-9-24)23-20(18)26/h4-7,10-11,18,24H,8-9H2,1-3H3,(H,23,26) |
| InChIKey | ODKZGMVEHNJUOT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|