C17H17ClN2O2S — CID 91567674
3-[2-(4-chlorophenyl)-5-methyl-1,3-thiazol-4-yl]-6,6-dimethylpiperidine-2,4-dione (PubChem CID 91567674) has the molecular formula C17H17ClN2O2S and a molecular weight of 348.86 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)-5-methyl-1,3-thiazol-4-yl]-6,6-dimethylpiperidine-2,4-dione.
| Compound Name | 3-[2-(4-chlorophenyl)-5-methyl-1,3-thiazol-4-yl]-6,6-dimethylpiperidine-2,4-dione |
|---|---|
| PubChem CID | 91567674 |
| Molecular Formula | C17H17ClN2O2S |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 3-[2-(4-chlorophenyl)-5-methyl-1,3-thiazol-4-yl]-6,6-dimethylpiperidine-2,4-dione |
| SMILES | Cc1sc(-c2ccc(Cl)cc2)nc1C1C(=O)CC(C)(C)NC1=O |
| InChI | InChI=1S/C17H17ClN2O2S/c1-9-14(13-12(21)8-17(2,3)20-15(13)22)19-16(23-9)10-4-6-11(18)7-5-10/h4-7,13H,8H2,1-3H3,(H,20,22) |
| InChIKey | DKYDHDIVDGAAJU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|