C21H20ClNO3S — CID 77456033
2-[2-(4-chlorophenyl)-5-methyl-1,3-thiazol-4-yl]-4-(oxan-4-ylmethylidene)cyclopentane-1,3-dione (PubChem CID 77456033) has the molecular formula C21H20ClNO3S and a molecular weight of 401.92 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-5-methyl-1,3-thiazol-4-yl]-4-(oxan-4-ylmethylidene)cyclopentane-1,3-dione.
| Compound Name | 2-[2-(4-chlorophenyl)-5-methyl-1,3-thiazol-4-yl]-4-(oxan-4-ylmethylidene)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 77456033 |
| Molecular Formula | C21H20ClNO3S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-5-methyl-1,3-thiazol-4-yl]-4-(oxan-4-ylmethylidene)cyclopentane-1,3-dione |
| SMILES | Cc1sc(-c2ccc(Cl)cc2)nc1C1C(=O)CC(=CC2CCOCC2)C1=O |
| InChI | InChI=1S/C21H20ClNO3S/c1-12-19(23-21(27-12)14-2-4-16(22)5-3-14)18-17(24)11-15(20(18)25)10-13-6-8-26-9-7-13/h2-5,10,13,18H,6-9,11H2,1H3 |
| InChIKey | YCERKGPYNVECQR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|