C20H19NO4S — CID 88579720
methyl 4-[4-[(1S,5S)-2,4-dioxo-3-bicyclo[3.2.1]octanyl]-5-methyl-1,3-thiazol-2-yl]benzoate (PubChem CID 88579720) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is methyl 4-[4-[(1S,5S)-2,4-dioxo-3-bicyclo[3.2.1]octanyl]-5-methyl-1,3-thiazol-2-yl]benzoate.
| Compound Name | methyl 4-[4-[(1S,5S)-2,4-dioxo-3-bicyclo[3.2.1]octanyl]-5-methyl-1,3-thiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 88579720 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | methyl 4-[4-[(1S,5S)-2,4-dioxo-3-bicyclo[3.2.1]octanyl]-5-methyl-1,3-thiazol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nc(C3C(=O)[C@H]4CC[C@@H](C4)C3=O)c(C)s2)cc1 |
| InChI | InChI=1S/C20H19NO4S/c1-10-16(15-17(22)13-7-8-14(9-13)18(15)23)21-19(26-10)11-3-5-12(6-4-11)20(24)25-2/h3-6,13-15H,7-9H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | ADRUEHLLZXWRTK-KBPBESRZSA-N |
| XLogP | 3.56 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|