C20H18O4S — CID 66742060
4-[4-(2,4-dioxo-3-bicyclo[3.2.1]octanyl)-5-methylthiophen-2-yl]benzoic acid (PubChem CID 66742060) has the molecular formula C20H18O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is 4-[4-(2,4-dioxo-3-bicyclo[3.2.1]octanyl)-5-methylthiophen-2-yl]benzoic acid.
| Compound Name | 4-[4-(2,4-dioxo-3-bicyclo[3.2.1]octanyl)-5-methylthiophen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 66742060 |
| Molecular Formula | C20H18O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 4-[4-(2,4-dioxo-3-bicyclo[3.2.1]octanyl)-5-methylthiophen-2-yl]benzoic acid |
| SMILES | Cc1sc(-c2ccc(C(=O)O)cc2)cc1C1C(=O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C20H18O4S/c1-10-15(17-18(21)13-6-7-14(8-13)19(17)22)9-16(25-10)11-2-4-12(5-3-11)20(23)24/h2-5,9,13-14,17H,6-8H2,1H3,(H,23,24) |
| InChIKey | XQXZXQUKAIFGJW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|