C24H22O2S — CID 90914639
(1R,5S)-3-[5-(1-benzothiophen-2-yl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 90914639) has the molecular formula C24H22O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is (1R,5S)-3-[5-(1-benzothiophen-2-yl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5S)-3-[5-(1-benzothiophen-2-yl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 90914639 |
| Molecular Formula | C24H22O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (1R,5S)-3-[5-(1-benzothiophen-2-yl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(-c2cc3ccccc3s2)cc1C1C(=O)[C@@H]2CC[C@@H](C2)C1=O |
| InChI | InChI=1S/C24H22O2S/c1-2-14-7-8-16(21-13-15-5-3-4-6-20(15)27-21)12-19(14)22-23(25)17-9-10-18(11-17)24(22)26/h3-8,12-13,17-18,22H,2,9-11H2,1H3/t17-,18+,22? |
| InChIKey | XXCOKMCEMKPVSR-VSOVRNOCSA-N |
| XLogP | 5.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|