C32H18N2O2S2 — CID 102341075
(3E)-6-(1-benzothiophen-2-yl)-3-[6-(1-benzothiophen-2-yl)-2-oxo-1H-indol-3-ylidene]-1H-indol-2-one (PubChem CID 102341075) has the molecular formula C32H18N2O2S2 and a molecular weight of 526.64 g/mol. Its IUPAC name is (3E)-6-(1-benzothiophen-2-yl)-3-[6-(1-benzothiophen-2-yl)-2-oxo-1H-indol-3-ylidene]-1H-indol-2-one.
| Compound Name | (3E)-6-(1-benzothiophen-2-yl)-3-[6-(1-benzothiophen-2-yl)-2-oxo-1H-indol-3-ylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 102341075 |
| Molecular Formula | C32H18N2O2S2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | (3E)-6-(1-benzothiophen-2-yl)-3-[6-(1-benzothiophen-2-yl)-2-oxo-1H-indol-3-ylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2cc(-c3cc4ccccc4s3)ccc2/C1=C1\C(=O)Nc2cc(-c3cc4ccccc4s3)ccc21 |
| InChI | InChI=1S/C32H18N2O2S2/c35-31-29(21-11-9-19(13-23(21)33-31)27-15-17-5-1-3-7-25(17)37-27)30-22-12-10-20(14-24(22)34-32(30)36)28-16-18-6-2-4-8-26(18)38-28/h1-16H,(H,33,35)(H,34,36)/b30-29+ |
| InChIKey | AUNUIVMWIUFPAF-QVIHXGFCSA-N |
| XLogP | 8.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|