C14H9BS — CID 59413459
CID 59413459 (PubChem CID 59413459) has the molecular formula C14H9BS and a molecular weight of 220.11 g/mol.
| Compound Name | CID 59413459 |
|---|---|
| PubChem CID | 59413459 |
| Molecular Formula | C14H9BS |
| Molecular Weight | 220.11 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2cc3ccccc3s2)cc1 |
| InChI | InChI=1S/C14H9BS/c15-12-7-5-10(6-8-12)14-9-11-3-1-2-4-13(11)16-14/h1-9H |
| InChIKey | GAIVYYMJNKUCRS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.11 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|