C16H15BS — CID 178024724
CID 178024724 (PubChem CID 178024724) has the molecular formula C16H15BS and a molecular weight of 250.18 g/mol.
| Compound Name | CID 178024724 |
|---|---|
| PubChem CID | 178024724 |
| Molecular Formula | C16H15BS |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | — |
| SMILES | CC.[B]c1ccc2sc(-c3ccccc3)cc2c1 |
| InChI | InChI=1S/C14H9BS.C2H6/c15-12-6-7-13-11(8-12)9-14(16-13)10-4-2-1-3-5-10;1-2/h1-9H;1-2H3 |
| InChIKey | RBULMLBTMUZKIE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|