C25H24N2O2S — CID 156558103
ethyl 1-[6-(1-benzothiophen-2-yl)quinolin-2-yl]piperidine-4-carboxylate (PubChem CID 156558103) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is ethyl 1-[6-(1-benzothiophen-2-yl)quinolin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-(1-benzothiophen-2-yl)quinolin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 156558103 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | ethyl 1-[6-(1-benzothiophen-2-yl)quinolin-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc3cc(-c4cc5ccccc5s4)ccc3n2)CC1 |
| InChI | InChI=1S/C25H24N2O2S/c1-2-29-25(28)17-11-13-27(14-12-17)24-10-8-18-15-20(7-9-21(18)26-24)23-16-19-5-3-4-6-22(19)30-23/h3-10,15-17H,2,11-14H2,1H3 |
| InChIKey | CSYKDFAIKIIKEI-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |