C19H23N3O3 — CID 122142945
ethyl 2-[(1-quinolin-2-ylpiperidine-4-carbonyl)amino]acetate (PubChem CID 122142945) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is ethyl 2-[(1-quinolin-2-ylpiperidine-4-carbonyl)amino]acetate.
| Compound Name | ethyl 2-[(1-quinolin-2-ylpiperidine-4-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 122142945 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | ethyl 2-[(1-quinolin-2-ylpiperidine-4-carbonyl)amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C1CCN(c2ccc3ccccc3n2)CC1 |
| InChI | InChI=1S/C19H23N3O3/c1-2-25-18(23)13-20-19(24)15-9-11-22(12-10-15)17-8-7-14-5-3-4-6-16(14)21-17/h3-8,15H,2,9-13H2,1H3,(H,20,24) |
| InChIKey | POIWUENVPMHCCS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |