C19H24N2O3 — CID 2852074
ethyl 1-(6-methoxy-4-methylquinolin-2-yl)piperidine-4-carboxylate (PubChem CID 2852074) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is ethyl 1-(6-methoxy-4-methylquinolin-2-yl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(6-methoxy-4-methylquinolin-2-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 2852074 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | ethyl 1-(6-methoxy-4-methylquinolin-2-yl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2cc(C)c3cc(OC)ccc3n2)CC1 |
| InChI | InChI=1S/C19H24N2O3/c1-4-24-19(22)14-7-9-21(10-8-14)18-11-13(2)16-12-15(23-3)5-6-17(16)20-18/h5-6,11-12,14H,4,7-10H2,1-3H3 |
| InChIKey | GHDMEULXSDAMQA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |