C26H26Cl3N5O2 — CID 158633521
2,6-dichloroquinolin-5-amine;ethyl 1-(5-amino-6-chloroquinolin-2-yl)piperidine-4-carboxylate (PubChem CID 158633521) has the molecular formula C26H26Cl3N5O2 and a molecular weight of 546.89 g/mol. Its IUPAC name is 2,6-dichloroquinolin-5-amine;ethyl 1-(5-amino-6-chloroquinolin-2-yl)piperidine-4-carboxylate.
| Compound Name | 2,6-dichloroquinolin-5-amine;ethyl 1-(5-amino-6-chloroquinolin-2-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 158633521 |
| Molecular Formula | C26H26Cl3N5O2 |
| Molecular Weight | 546.89 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 2,6-dichloroquinolin-5-amine;ethyl 1-(5-amino-6-chloroquinolin-2-yl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc3c(N)c(Cl)ccc3n2)CC1.Nc1c(Cl)ccc2nc(Cl)ccc12 |
| InChI | InChI=1S/C17H20ClN3O2.C9H6Cl2N2/c1-2-23-17(22)11-7-9-21(10-8-11)15-6-3-12-14(20-15)5-4-13(18)16(12)19;10-6-2-3-7-5(9(6)12)1-4-8(11)13-7/h3-6,11H,2,7-10,19H2,1H3;1-4H,12H2 |
| InChIKey | HZMDQCMYWAILBP-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.89 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|