C29H36ClN3O3 — CID 86621833
ethyl 1-[5-[[2-(1-adamantyl)acetyl]amino]-6-chloroquinolin-2-yl]piperidine-4-carboxylate (PubChem CID 86621833) has the molecular formula C29H36ClN3O3 and a molecular weight of 510.08 g/mol. Its IUPAC name is ethyl 1-[5-[[2-(1-adamantyl)acetyl]amino]-6-chloroquinolin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-[[2-(1-adamantyl)acetyl]amino]-6-chloroquinolin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 86621833 |
| Molecular Formula | C29H36ClN3O3 |
| Molecular Weight | 510.08 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | ethyl 1-[5-[[2-(1-adamantyl)acetyl]amino]-6-chloroquinolin-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc3c(NC(=O)CC45CC6CC(CC(C6)C4)C5)c(Cl)ccc3n2)CC1 |
| InChI | InChI=1S/C29H36ClN3O3/c1-2-36-28(35)21-7-9-33(10-8-21)25-6-3-22-24(31-25)5-4-23(30)27(22)32-26(34)17-29-14-18-11-19(15-29)13-20(12-18)16-29/h3-6,18-21H,2,7-17H2,1H3,(H,32,34) |
| InChIKey | OSLAVHZEUGFEEI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.08 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |