C22H28ClN3O — CID 142972253
N-(6-chloro-2-piperidin-1-ylquinolin-5-yl)-2-cyclohexylacetamide (PubChem CID 142972253) has the molecular formula C22H28ClN3O and a molecular weight of 385.94 g/mol. Its IUPAC name is N-(6-chloro-2-piperidin-1-ylquinolin-5-yl)-2-cyclohexylacetamide.
| Compound Name | N-(6-chloro-2-piperidin-1-ylquinolin-5-yl)-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 142972253 |
| Molecular Formula | C22H28ClN3O |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-(6-chloro-2-piperidin-1-ylquinolin-5-yl)-2-cyclohexylacetamide |
| SMILES | O=C(CC1CCCCC1)Nc1c(Cl)ccc2nc(N3CCCCC3)ccc12 |
| InChI | InChI=1S/C22H28ClN3O/c23-18-10-11-19-17(9-12-20(24-19)26-13-5-2-6-14-26)22(18)25-21(27)15-16-7-3-1-4-8-16/h9-12,16H,1-8,13-15H2,(H,25,27) |
| InChIKey | JXZCBUMMYPKPHS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |