C21H20ClFN4O2 — CID 24995088
N-[6-chloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]quinolin-5-yl]-2-(4-fluoroanilino)acetamide (PubChem CID 24995088) has the molecular formula C21H20ClFN4O2 and a molecular weight of 414.87 g/mol. Its IUPAC name is N-[6-chloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]quinolin-5-yl]-2-(4-fluoroanilino)acetamide.
| Compound Name | N-[6-chloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]quinolin-5-yl]-2-(4-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 24995088 |
| Molecular Formula | C21H20ClFN4O2 |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | N-[6-chloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]quinolin-5-yl]-2-(4-fluoroanilino)acetamide |
| SMILES | O=C(CNc1ccc(F)cc1)Nc1c(Cl)ccc2nc(N3CC[C@@H](O)C3)ccc12 |
| InChI | InChI=1S/C21H20ClFN4O2/c22-17-6-7-18-16(5-8-19(25-18)27-10-9-15(28)12-27)21(17)26-20(29)11-24-14-3-1-13(23)2-4-14/h1-8,15,24,28H,9-12H2,(H,26,29)/t15-/m1/s1 |
| InChIKey | FIVQCOYSOIKUNQ-OAHLLOKOSA-N |
| XLogP | 3.65 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |