C30H47ClN4O2Si — CID 68808571
N-[2-[(3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]piperidin-1-yl]-6-chloroquinolin-5-yl]-2-cyclohexylacetamide (PubChem CID 68808571) has the molecular formula C30H47ClN4O2Si and a molecular weight of 559.27 g/mol. Its IUPAC name is N-[2-[(3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]piperidin-1-yl]-6-chloroquinolin-5-yl]-2-cyclohexylacetamide.
| Compound Name | N-[2-[(3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]piperidin-1-yl]-6-chloroquinolin-5-yl]-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 68808571 |
| Molecular Formula | C30H47ClN4O2Si |
| Molecular Weight | 559.27 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | N-[2-[(3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]piperidin-1-yl]-6-chloroquinolin-5-yl]-2-cyclohexylacetamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCN[C@H]1CCCN(c2ccc3c(NC(=O)CC4CCCCC4)c(Cl)ccc3n2)C1 |
| InChI | InChI=1S/C30H47ClN4O2Si/c1-30(2,3)38(4,5)37-19-17-32-23-12-9-18-35(21-23)27-16-13-24-26(33-27)15-14-25(31)29(24)34-28(36)20-22-10-7-6-8-11-22/h13-16,22-23,32H,6-12,17-21H2,1-5H3,(H,34,36)/t23-/m0/s1 |
| InChIKey | OQRGSTXNYNLERN-QHCPKHFHSA-N |
| XLogP | 7.38 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.27 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|