C25H35Cl3N4O2 — CID 69071923
2-(1-adamantyl)-N-[6-chloro-2-[2-(2-hydroxyethylamino)ethylamino]quinolin-5-yl]acetamide;dihydrochloride (PubChem CID 69071923) has the molecular formula C25H35Cl3N4O2 and a molecular weight of 529.94 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[6-chloro-2-[2-(2-hydroxyethylamino)ethylamino]quinolin-5-yl]acetamide;dihydrochloride.
| Compound Name | 2-(1-adamantyl)-N-[6-chloro-2-[2-(2-hydroxyethylamino)ethylamino]quinolin-5-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 69071923 |
| Molecular Formula | C25H35Cl3N4O2 |
| Molecular Weight | 529.94 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 2-(1-adamantyl)-N-[6-chloro-2-[2-(2-hydroxyethylamino)ethylamino]quinolin-5-yl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC12CC3CC(CC(C3)C1)C2)Nc1c(Cl)ccc2nc(NCCNCCO)ccc12 |
| InChI | InChI=1S/C25H33ClN4O2.2ClH/c26-20-2-3-21-19(1-4-22(29-21)28-6-5-27-7-8-31)24(20)30-23(32)15-25-12-16-9-17(13-25)11-18(10-16)14-25;;/h1-4,16-18,27,31H,5-15H2,(H,28,29)(H,30,32);2*1H |
| InChIKey | AOZWTEBEDNDWNP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.94 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|