C30H44N4O — CID 10288775
2-(1-adamantyl)-N-[2-[2-(heptylamino)ethylamino]quinolin-5-yl]acetamide (PubChem CID 10288775) has the molecular formula C30H44N4O and a molecular weight of 476.71 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-[2-(heptylamino)ethylamino]quinolin-5-yl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-[2-(heptylamino)ethylamino]quinolin-5-yl]acetamide |
|---|---|
| PubChem CID | 10288775 |
| Molecular Formula | C30H44N4O |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.35 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-[2-(heptylamino)ethylamino]quinolin-5-yl]acetamide |
| SMILES | CCCCCCCNCCNc1ccc2c(NC(=O)CC34CC5CC(CC(C5)C3)C4)cccc2n1 |
| InChI | InChI=1S/C30H44N4O/c1-2-3-4-5-6-12-31-13-14-32-28-11-10-25-26(33-28)8-7-9-27(25)34-29(35)21-30-18-22-15-23(19-30)17-24(16-22)20-30/h7-11,22-24,31H,2-6,12-21H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | ADIIVHSKPMBTFA-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|