C29H42N4O2 — CID 70971835
N-[2-[2-(2-propoxyethylamino)ethylamino]quinolin-5-yl]-2-[(7S)-7-tricyclo[5.3.1.03,9]undecanyl]acetamide (PubChem CID 70971835) has the molecular formula C29H42N4O2 and a molecular weight of 478.68 g/mol. Its IUPAC name is N-[2-[2-(2-propoxyethylamino)ethylamino]quinolin-5-yl]-2-[(7S)-7-tricyclo[5.3.1.03,9]undecanyl]acetamide.
| Compound Name | N-[2-[2-(2-propoxyethylamino)ethylamino]quinolin-5-yl]-2-[(7S)-7-tricyclo[5.3.1.03,9]undecanyl]acetamide |
|---|---|
| PubChem CID | 70971835 |
| Molecular Formula | C29H42N4O2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | N-[2-[2-(2-propoxyethylamino)ethylamino]quinolin-5-yl]-2-[(7S)-7-tricyclo[5.3.1.03,9]undecanyl]acetamide |
| SMILES | CCCOCCNCCNc1ccc2c(NC(=O)C[C@]34CCCC5CC(CC5C3)C4)cccc2n1 |
| InChI | InChI=1S/C29H42N4O2/c1-2-14-35-15-13-30-11-12-31-27-9-8-24-25(32-27)6-3-7-26(24)33-28(34)20-29-10-4-5-22-16-21(18-29)17-23(22)19-29/h3,6-9,21-23,30H,2,4-5,10-20H2,1H3,(H,31,32)(H,33,34)/t21?,22?,23?,29-/m0/s1 |
| InChIKey | HCFMTGJNTNMCTR-URVZYQOPSA-N |
| XLogP | 5.60 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|