C29H36N4O3 — CID 10128120
2-(1-adamantyl)-N-[2-[2-[[5-(hydroxymethyl)furan-2-yl]methylamino]ethylamino]quinolin-5-yl]acetamide (PubChem CID 10128120) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-[2-[[5-(hydroxymethyl)furan-2-yl]methylamino]ethylamino]quinolin-5-yl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-[2-[[5-(hydroxymethyl)furan-2-yl]methylamino]ethylamino]quinolin-5-yl]acetamide |
|---|---|
| PubChem CID | 10128120 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-[2-[[5-(hydroxymethyl)furan-2-yl]methylamino]ethylamino]quinolin-5-yl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)Nc1cccc2nc(NCCNCc3ccc(CO)o3)ccc12 |
| InChI | InChI=1S/C29H36N4O3/c34-18-23-5-4-22(36-23)17-30-8-9-31-27-7-6-24-25(32-27)2-1-3-26(24)33-28(35)16-29-13-19-10-20(14-29)12-21(11-19)15-29/h1-7,19-21,30,34H,8-18H2,(H,31,32)(H,33,35) |
| InChIKey | DKYNXYAQDJDDQG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|