C25H34N4O2 — CID 10127096
2-(1-adamantyl)-N-[2-[2-aminoethyl(2-hydroxyethyl)amino]quinolin-5-yl]acetamide (PubChem CID 10127096) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-[2-aminoethyl(2-hydroxyethyl)amino]quinolin-5-yl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-[2-aminoethyl(2-hydroxyethyl)amino]quinolin-5-yl]acetamide |
|---|---|
| PubChem CID | 10127096 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-[2-aminoethyl(2-hydroxyethyl)amino]quinolin-5-yl]acetamide |
| SMILES | NCCN(CCO)c1ccc2c(NC(=O)CC34CC5CC(CC(C5)C3)C4)cccc2n1 |
| InChI | InChI=1S/C25H34N4O2/c26-6-7-29(8-9-30)23-5-4-20-21(27-23)2-1-3-22(20)28-24(31)16-25-13-17-10-18(14-25)12-19(11-17)15-25/h1-5,17-19,30H,6-16,26H2,(H,28,31) |
| InChIKey | QULFKNATRINTRO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |