C23H20N2O2S — CID 174215132
1-[6-(1-benzothiophen-2-yl)quinolin-2-yl]piperidine-4-carboxylic acid (PubChem CID 174215132) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[6-(1-benzothiophen-2-yl)quinolin-2-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-(1-benzothiophen-2-yl)quinolin-2-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 174215132 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-[6-(1-benzothiophen-2-yl)quinolin-2-yl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2ccc3cc(-c4cc5ccccc5s4)ccc3n2)CC1 |
| InChI | InChI=1S/C23H20N2O2S/c26-23(27)15-9-11-25(12-10-15)22-8-6-16-13-18(5-7-19(16)24-22)21-14-17-3-1-2-4-20(17)28-21/h1-8,13-15H,9-12H2,(H,26,27) |
| InChIKey | BELBJJGSQLQSDU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |