C22H21ClN2O3 — CID 174215034
1-[6-(4-chloro-3-methoxyphenyl)quinolin-2-yl]piperidine-4-carboxylic acid (PubChem CID 174215034) has the molecular formula C22H21ClN2O3 and a molecular weight of 396.87 g/mol. Its IUPAC name is 1-[6-(4-chloro-3-methoxyphenyl)quinolin-2-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-(4-chloro-3-methoxyphenyl)quinolin-2-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 174215034 |
| Molecular Formula | C22H21ClN2O3 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 1-[6-(4-chloro-3-methoxyphenyl)quinolin-2-yl]piperidine-4-carboxylic acid |
| SMILES | COc1cc(-c2ccc3nc(N4CCC(C(=O)O)CC4)ccc3c2)ccc1Cl |
| InChI | InChI=1S/C22H21ClN2O3/c1-28-20-13-16(2-5-18(20)23)15-3-6-19-17(12-15)4-7-21(24-19)25-10-8-14(9-11-25)22(26)27/h2-7,12-14H,8-11H2,1H3,(H,26,27) |
| InChIKey | VFGXHTXPFXSWIU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |