C18H21ClN4O3 — CID 113192836
1-[6-(4-chloro-2-methoxy-5-methylanilino)pyrimidin-4-yl]piperidine-4-carboxylic acid (PubChem CID 113192836) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is 1-[6-(4-chloro-2-methoxy-5-methylanilino)pyrimidin-4-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-(4-chloro-2-methoxy-5-methylanilino)pyrimidin-4-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 113192836 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 1-[6-(4-chloro-2-methoxy-5-methylanilino)pyrimidin-4-yl]piperidine-4-carboxylic acid |
| SMILES | COc1cc(Cl)c(C)cc1Nc1cc(N2CCC(C(=O)O)CC2)ncn1 |
| InChI | InChI=1S/C18H21ClN4O3/c1-11-7-14(15(26-2)8-13(11)19)22-16-9-17(21-10-20-16)23-5-3-12(4-6-23)18(24)25/h7-10,12H,3-6H2,1-2H3,(H,24,25)(H,20,21,22) |
| InChIKey | GOXRPFKNMVFJEC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |