C17H19ClN4O2 — CID 113192699
1-[6-[(2-chlorophenyl)methylamino]pyrimidin-4-yl]piperidine-4-carboxylic acid (PubChem CID 113192699) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 1-[6-[(2-chlorophenyl)methylamino]pyrimidin-4-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-[(2-chlorophenyl)methylamino]pyrimidin-4-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 113192699 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-[6-[(2-chlorophenyl)methylamino]pyrimidin-4-yl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2cc(NCc3ccccc3Cl)ncn2)CC1 |
| InChI | InChI=1S/C17H19ClN4O2/c18-14-4-2-1-3-13(14)10-19-15-9-16(21-11-20-15)22-7-5-12(6-8-22)17(23)24/h1-4,9,11-12H,5-8,10H2,(H,23,24)(H,19,20,21) |
| InChIKey | HFAWNABFOKLSQQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |