C14H9NO2S — CID 53223621
5-(1-benzothiophen-2-yl)pyridine-2-carboxylic acid (PubChem CID 53223621) has the molecular formula C14H9NO2S and a molecular weight of 255.30 g/mol. Its IUPAC name is 5-(1-benzothiophen-2-yl)pyridine-2-carboxylic acid.
| Compound Name | 5-(1-benzothiophen-2-yl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 53223621 |
| Molecular Formula | C14H9NO2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 5-(1-benzothiophen-2-yl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2cc3ccccc3s2)cn1 |
| InChI | InChI=1S/C14H9NO2S/c16-14(17)11-6-5-10(8-15-11)13-7-9-3-1-2-4-12(9)18-13/h1-8H,(H,16,17) |
| InChIKey | MJMFRKSXXAVLGY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |