C63H41N3S3 — CID 145132470
(Z)-1-[5-[2-[3,5-bis[2-[6-(1-benzothiophen-2-yl)-3-pyridinyl]phenyl]phenyl]phenyl]-2-pyridinyl]-2-phenylethenethiol (PubChem CID 145132470) has the molecular formula C63H41N3S3 and a molecular weight of 936.24 g/mol. Its IUPAC name is (Z)-1-[5-[2-[3,5-bis[2-[6-(1-benzothiophen-2-yl)-3-pyridinyl]phenyl]phenyl]phenyl]-2-pyridinyl]-2-phenylethenethiol.
| Compound Name | (Z)-1-[5-[2-[3,5-bis[2-[6-(1-benzothiophen-2-yl)-3-pyridinyl]phenyl]phenyl]phenyl]-2-pyridinyl]-2-phenylethenethiol |
|---|---|
| PubChem CID | 145132470 |
| Molecular Formula | C63H41N3S3 |
| Molecular Weight | 936.24 g/mol |
| Exact Mass | 935.25 |
| IUPAC Name | (Z)-1-[5-[2-[3,5-bis[2-[6-(1-benzothiophen-2-yl)-3-pyridinyl]phenyl]phenyl]phenyl]-2-pyridinyl]-2-phenylethenethiol |
| SMILES | S/C(=C\c1ccccc1)c1ccc(-c2ccccc2-c2cc(-c3ccccc3-c3ccc(-c4cc5ccccc5s4)nc3)cc(-c3ccccc3-c3ccc(-c4cc5ccccc5s4)nc3)c2)cn1 |
| InChI | InChI=1S/C63H41N3S3/c67-59(32-41-14-2-1-3-15-41)56-29-26-44(38-64-56)50-18-6-9-21-53(50)47-33-48(54-22-10-7-19-51(54)45-27-30-57(65-39-45)62-36-42-16-4-12-24-60(42)68-62)35-49(34-47)55-23-11-8-20-52(55)46-28-31-58(66-40-46)63-37-43-17-5-13-25-61(43)69-63/h1-40,67H/b59-32- |
| InChIKey | NKIAHDBTDZPGBS-CGZNQIEZSA-N |
| XLogP | 18.06 |
| TPSA | 38.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.24 |
| LogP ≤ 5 | 18.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|