C16H16NS2+ — CID 163528425
[5-(1-benzothiophen-2-yl)-2-ethylsulfanylphenyl]azanium (PubChem CID 163528425) has the molecular formula C16H16NS2+ and a molecular weight of 286.45 g/mol. Its IUPAC name is [5-(1-benzothiophen-2-yl)-2-ethylsulfanylphenyl]azanium.
| Compound Name | [5-(1-benzothiophen-2-yl)-2-ethylsulfanylphenyl]azanium |
|---|---|
| PubChem CID | 163528425 |
| Molecular Formula | C16H16NS2+ |
| Molecular Weight | 286.45 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | [5-(1-benzothiophen-2-yl)-2-ethylsulfanylphenyl]azanium |
| SMILES | CCSc1ccc(-c2cc3ccccc3s2)cc1[NH3+] |
| InChI | InChI=1S/C16H15NS2/c1-2-18-15-8-7-12(9-13(15)17)16-10-11-5-3-4-6-14(11)19-16/h3-10H,2,17H2,1H3/p+1 |
| InChIKey | DQVQLUDORWCTLC-UHFFFAOYSA-O |
| XLogP | 4.55 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |