C12H11NO3S — CID 1474031
methyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate (PubChem CID 1474031) has the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. Its IUPAC name is methyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate.
| Compound Name | methyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 1474031 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | methyl 4-(4-hydroxy-5-methyl-1,3-thiazol-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2nc(O)c(C)s2)cc1 |
| InChI | InChI=1S/C12H11NO3S/c1-7-10(14)13-11(17-7)8-3-5-9(6-4-8)12(15)16-2/h3-6,14H,1-2H3 |
| InChIKey | PIMOKRKXBVBGIP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |