C16H16N2O2S — CID 91226165
5,5-dimethyl-3-(5-methyl-2-phenyl-1,3-thiazol-4-yl)pyrrolidine-2,4-dione (PubChem CID 91226165) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 5,5-dimethyl-3-(5-methyl-2-phenyl-1,3-thiazol-4-yl)pyrrolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-(5-methyl-2-phenyl-1,3-thiazol-4-yl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 91226165 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 5,5-dimethyl-3-(5-methyl-2-phenyl-1,3-thiazol-4-yl)pyrrolidine-2,4-dione |
| SMILES | Cc1sc(-c2ccccc2)nc1C1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C16H16N2O2S/c1-9-12(11-13(19)16(2,3)18-14(11)20)17-15(21-9)10-7-5-4-6-8-10/h4-8,11H,1-3H3,(H,18,20) |
| InChIKey | DSFYWTPKKDNUMF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|